933756-55-9 Usage
Uses
Used in Pharmaceutical Industry:
(5-Benzyl-1,3,4-oxadiazol-2-yl)methanamine is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and properties may contribute to the development of new therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Industry:
(5-Benzyl-1,3,4-oxadiazol-2-yl)methanamine is used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its potential biological activities and chemical properties may enhance the effectiveness and selectivity of these agrochemicals.
Used in Materials Science:
(5-Benzyl-1,3,4-oxadiazol-2-yl)methanamine is used as a component in the development of new materials with specific properties. Its unique structure and chemical properties may contribute to the creation of materials with improved performance in various applications, such as coatings, adhesives, and polymers.
Further research and development of (5-Benzyl-1,3,4-oxadiazol-2-yl)methanamine could lead to its use in additional industries and applications, expanding its potential impact and value.
Check Digit Verification of cas no
The CAS Registry Mumber 933756-55-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,3,7,5 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 933756-55:
(8*9)+(7*3)+(6*3)+(5*7)+(4*5)+(3*6)+(2*5)+(1*5)=199
199 % 10 = 9
So 933756-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O/c11-7-10-13-12-9(14-10)6-8-4-2-1-3-5-8/h1-5H,6-7,11H2
933756-55-9Relevant academic research and scientific papers
PYRAZOLE COMPOUNDS AND USE THEREOF
-
Page/Page column 58, (2009/05/29)
The pyrazole compound of the present invention is represented by the following general formula (I). The pyrazole compound of the present invention or a salt thereof or a solvate thereof potently inhibits liver glycogen phosphorylase, and, therefore, is useful as a therapeutic or prophylactic agent for diabetes. wherein each symbol denotes as described in the specifications.
