93483-94-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(3-Bromopropyl)benzimidazole is used as an intermediate in the synthesis of benzimidazole derivatives, which are known for their potential biological activity. The presence of the 3-bromopropyl group allows for further chemical modifications, leading to the creation of new compounds with therapeutic properties.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-(3-Bromopropyl)benzimidazole serves as a research tool for studying the structure and function of benzimidazole-containing molecules. Its reactivity and the ability to undergo various chemical reactions make it instrumental in exploring the potential applications of these molecules in drug discovery and development.
Used in Drug Development:
2-(3-Bromopropyl)benzimidazole is utilized in the development of new drugs, particularly those targeting specific biological pathways or diseases. Its versatility in chemical reactions allows for the creation of a wide range of benzimidazole-based compounds with diverse pharmacological properties, contributing to the advancement of therapeutic options.
Used in Chemical Reactions:
As a building block in chemical reactions, 2-(3-Bromopropyl)benzimidazole is employed to synthesize a variety of novel compounds with potential applications in different industries, including pharmaceuticals, agrochemicals, and materials science. Its reactivity and the presence of the 3-bromopropyl group make it a key component in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 93483-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,4,8 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 93483-94:
(7*9)+(6*3)+(5*4)+(4*8)+(3*3)+(2*9)+(1*4)=164
164 % 10 = 4
So 93483-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrN2/c11-7-3-6-10-12-8-4-1-2-5-9(8)13-10/h1-2,4-5H,3,6-7H2,(H,12,13)
