935547-73-2

Usage

Uses

Used in Pharmaceutical and Agrochemical Synthesis:
5-(1H-Imidazol-1-yl)-2-pyridinamine is used as a key building block for the development of new pharmaceuticals and agrochemicals. Its unique structure allows for the creation of diverse molecules with potential therapeutic or pesticidal properties, contributing to the advancement of medicine and agriculture.
Used in Coordination Chemistry:
In the field of coordination chemistry, 5-(1H-Imidazol-1-yl)-2-pyridinamine serves as a versatile ligand, capable of forming stable complexes with various metal ions. This application is crucial for the study of metal ion interactions and the development of new materials with specific properties, such as catalysts or sensors.
Used in Biological Research:
Due to its structural similarity to compounds found in living organisms, 5-(1H-Imidazol-1-yl)-2-pyridinamine is used in biological research to investigate its potential biological activity. This may include studying its interactions with biological targets, such as enzymes or receptors, and assessing its efficacy in various biological assays.
Used in Drug Delivery Systems:
Although not explicitly mentioned in the provided materials, given its potential biological activity and structural features, 5-(1H-Imidazol-1-yl)-2-pyridinamine could be explored for use in drug delivery systems. It might be employed to improve the solubility, stability, or targeted delivery of therapeutic agents, enhancing their bioavailability and efficacy.
Further research and study are essential to fully understand and harness the potential applications of 5-(1H-Imidazol-1-yl)-2-pyridinamine in these and other fields.

InChI:InChI=1/C5H3BrN4/c6-4-2-10-5(1-7-4)8-3-9-10/h1-3H