93560-60-2 Usage
Uses
Used in Organic Synthesis:
2-BROMO-3-(TETRAHYDRO-2-PYRANYLOXY)PYRIDINE is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for versatile chemical reactions, facilitating the synthesis of a wide range of compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-BROMO-3-(TETRAHYDRO-2-PYRANYLOXY)PYRIDINE is utilized as a building block for the synthesis of new drug candidates. Its potential biological activity and structural features make it a promising candidate for the development of innovative medicinal products.
Used as a Pharmaceutical Intermediate:
2-BROMO-3-(TETRAHYDRO-2-PYRANYLOXY)PYRIDINE holds potential as a pharmaceutical intermediate in the production of pharmaceuticals. Its presence in the synthesis process can contribute to the development of new drugs with improved efficacy and safety profiles.
Used in the Development of New Medicinal Products:
2-BROMO-3-(TETRAHYDRO-2-PYRANYLOXY)PYRIDINE has been studied for its potential biological activity, which may lead to its application in the development of new medicinal products. Its unique chemical structure and properties could offer novel therapeutic opportunities in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 93560-60-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,5,6 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 93560-60:
(7*9)+(6*3)+(5*5)+(4*6)+(3*0)+(2*6)+(1*0)=142
142 % 10 = 2
So 93560-60-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BrNO2/c11-10-8(4-3-6-12-10)14-9-5-1-2-7-13-9/h3-4,6,9H,1-2,5,7H2
93560-60-2Relevant academic research and scientific papers
Synthesis and Properties of 2,2'-Bipyridin-3-ols and -3,3'-diols
Siemanowski, Werner,Witzel, Herbert
, p. 1731 - 1739 (2007/10/02)
The synthesis of the 2-furyl ketones 5-7 and 13 and their reaction with ammonium acetate in boiling acetic acid to 3-substituted 2,2'-bipyridines and to 2-(2-pyrimidinyl)-3-pyridinol (14) via a ring-transformation reaction are described.Strong intramolecular hydrogen bonds are responsible for their physical and chemical properties.