936940-07-7 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-aminoethyl)-1,3-oxazinan-2-one is used as a building block for the synthesis of various drugs and therapeutic compounds. Its unique structure allows for the development of new pharmaceuticals with improved efficacy and selectivity.
Used as a Chiral Auxiliary in Asymmetric Synthesis:
3-(2-aminoethyl)-1,3-oxazinan-2-one is used as a chiral auxiliary in asymmetric synthesis, a technique that allows for the selective formation of one enantiomer of a chiral compound over the other. This is crucial in the production of enantiomerically pure compounds, which are often required for pharmaceutical applications.
Used as a Ligand in Coordination Chemistry:
3-(2-aminoethyl)-1,3-oxazinan-2-one is used as a ligand in coordination chemistry, where it can form complexes with metal ions. These complexes have potential applications in various fields, such as catalysis, materials science, and supramolecular chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 936940-07-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,6,9,4 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 936940-07:
(8*9)+(7*3)+(6*6)+(5*9)+(4*4)+(3*0)+(2*0)+(1*7)=197
197 % 10 = 7
So 936940-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O2/c7-2-4-8-3-1-5-10-6(8)9/h1-5,7H2
