937595-70-5 Usage
Uses
Used in Organic Synthesis:
5-Chloro-2-fluoropyridin-3-ylboronic acid is used as a reagent in cross-coupling reactions for the construction of carbon-carbon and carbon-heteroatom bonds. Its unique structure and reactivity make it valuable in organic synthesis for creating new functional materials and biologically active compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-Chloro-2-fluoropyridin-3-ylboronic acid is used as an important building block for the development of new drugs. Its presence in various cross-coupling reactions allows for the synthesis of diverse bioactive molecules with potential therapeutic applications.
Used in Agrochemical Research:
Similarly, in agrochemical research, 5-Chloro-2-fluoropyridin-3-ylboronic acid is utilized as a key component in the synthesis of novel agrochemicals, contributing to the development of more effective and environmentally friendly pesticides and other agricultural products.
Used in Chemical Biology and Medicinal Chemistry Research:
The boronic acid group in 5-Chloro-2-fluoropyridin-3-ylboronic acid enables the formation of stable complexes with certain biomolecules. This property makes it useful in chemical biology and medicinal chemistry research, where it can be employed to study the interactions between small molecules and biological systems, potentially leading to the discovery of new therapeutic agents or diagnostic tools.
Check Digit Verification of cas no
The CAS Registry Mumber 937595-70-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,7,5,9 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 937595-70:
(8*9)+(7*3)+(6*7)+(5*5)+(4*9)+(3*5)+(2*7)+(1*0)=225
225 % 10 = 5
So 937595-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BClFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
