937595-71-6 Usage
General Description
2-Chloro-3-fluoropyridine-4-boronic acid is a chemical compound that belongs to the class of boronic acids. It consists of a pyridine ring with a chlorine atom at the 2-position, a fluorine atom at the 3-position, and a boronic acid group at the 4-position. 2-CHLORO-3-FLUOROPYRIDINE-4-BORONIC ACID is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is valued for its ability to form stable covalent bonds with other molecules, making it a useful tool in medicinal chemistry and drug discovery. Additionally, the boronic acid functionality allows for easy manipulation and derivatization of the molecule, making it a versatile and valuable intermediate in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 937595-71-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,7,5,9 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 937595-71:
(8*9)+(7*3)+(6*7)+(5*5)+(4*9)+(3*5)+(2*7)+(1*1)=226
226 % 10 = 6
So 937595-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BClFNO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2,10-11H
