937692-64-3 Usage
Uses
Used in Pharmaceutical Research and Development:
(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid is used as a chemical compound in pharmaceutical research and development for its unique structure and potential biological activities. Its chiral nature with two stereocenters (3S and 4R) may contribute to its potential as a candidate for the development of new drugs or drug delivery systems.
Used in Drug Synthesis:
(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid can be used as a building block or intermediate in the synthesis of various pharmaceutical compounds. Its carboxylic acid functional group and methoxyphenyl substituent may allow for the formation of diverse chemical entities with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid may be employed as a template or scaffold for the design and optimization of new drug candidates. Its unique structural features can be exploited to modulate the pharmacokinetic and pharmacodynamic properties of potential therapeutic agents.
Used in Drug Delivery Systems:
(3S,4R)-4-(3-Methoxyphenyl)pyrrolidine-3-carboxylic acid may also be utilized in the development of drug delivery systems, where its carboxylic acid group can be used for conjugation or attachment to various carriers, such as nanoparticles or polymers. This can enhance the solubility, stability, and targeted delivery of therapeutic agents, improving their overall efficacy and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 937692-64-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,7,6,9 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 937692-64:
(8*9)+(7*3)+(6*7)+(5*6)+(4*9)+(3*2)+(2*6)+(1*4)=223
223 % 10 = 3
So 937692-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c1-16-9-4-2-3-8(5-9)10-6-13-7-11(10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15)/t10-,11+/m0/s1
