937795-94-3 Usage
Description
4-[4-(Aminomethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is a complex chemical compound featuring a piperidine ring connected to a thieno[3,2-d]pyrimidine ring via an aminomethyl group. 4-[4-(Aminomethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is of significant interest in medicinal chemistry due to its potential pharmacological activities, with the piperidine ring being a common structural element in various pharmaceuticals, hinting at possible biological efficacy.
Uses
Used in Pharmaceutical Development:
4-[4-(Aminomethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is used as a lead compound for the development of new pharmaceuticals, given its unique structure and the presence of the piperidine ring, which is known to contribute to the biological activity of many drugs.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-[4-(Aminomethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine serves as a subject of research to explore its potential pharmacological properties and to understand how its structure can be optimized for specific therapeutic applications.
Used in Drug Design and Synthesis:
4-[4-(Aminomethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is utilized in drug design and synthesis processes to create novel compounds with improved pharmacological profiles, leveraging its structural features to enhance drug-target interactions and therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 937795-94-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,7,7,9 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 937795-94:
(8*9)+(7*3)+(6*7)+(5*7)+(4*9)+(3*5)+(2*9)+(1*4)=243
243 % 10 = 3
So 937795-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H7N3/c12-8-9-2-4-10(5-3-9)11-13-6-1-7-14-11/h1-7H
