93783-23-4 Usage
Chemical compound
A substance formed by a chemical reaction and having a definite composition and distinct properties.
Surfactant properties
The ability to reduce the surface tension between two liquids or between a liquid and a solid, making it useful in the production of emulsifiers, detergents, and corrosion inhibitors.
Industrial applications
Commonly used in various industrial applications due to its surfactant properties.
Imidazolium-based ionic liquid
A type of ionic liquid that is known for its low volatility and high thermal stability.
Low volatility
The compound does not easily evaporate or become a vapor at room temperature.
High thermal stability
The compound can withstand high temperatures without breaking down or decomposing.
Ethyl sulphate group
A functional group in the molecule that contributes to its surfactant properties.
Water-soluble
The presence of the hydroxyethyl group makes the compound soluble in water, enhancing its usefulness in various formulations.
Versatile chemical compound
The compound has valuable properties for industrial applications, making it a versatile choice for a wide range of uses.
Check Digit Verification of cas no
The CAS Registry Mumber 93783-23-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,7,8 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 93783-23:
(7*9)+(6*3)+(5*7)+(4*8)+(3*3)+(2*2)+(1*3)=164
164 % 10 = 4
So 93783-23-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H46N2O.C2H6O4S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23(4-2)18-19-24(22)20-21-25;1-2-6-7(3,4)5/h22,25H,3-21H2,1-2H3;2H2,1H3,(H,3,4,5)