93820-07-6 Usage
General Description
The chemical "4-[2-[[2-(acetoxy)ethyl]amino]-2-oxoethoxy]-1-hydroxy-2-naphthoic acid" is a complex compound with a molecular structure containing naphthoic acid and an acetoxyethylamine group. It is a derivative of 1-hydroxy-2-naphthoic acid, and features an additional acetoxyethylamine group attached to the 2nd carbon atom of the naphthoic acid ring. This chemical may have potential applications in pharmaceutical and medical research due to its structural features, which could contribute to its bioactivity and interaction with biological systems. Further study and investigation of this compound's properties and potential applications are needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 93820-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,8,2 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93820-07:
(7*9)+(6*3)+(5*8)+(4*2)+(3*0)+(2*0)+(1*7)=136
136 % 10 = 6
So 93820-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO7/c1-10(19)24-7-6-18-15(20)9-25-14-8-13(17(22)23)16(21)12-5-3-2-4-11(12)14/h2-5,8,21H,6-7,9H2,1H3,(H,18,20)(H,22,23)