938458-88-9 Usage
Uses
Used in Organic Synthesis:
1-Amino-piperidine-3-carboxylic acid ethyl ester is used as a key intermediate in the synthesis of various organic compounds. Its unique structure and functional groups make it a valuable building block for the development of new molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
1-Amino-piperidine-3-carboxylic acid ethyl ester is used as a precursor in the synthesis of pharmaceuticals. Its versatile chemical properties allow for the creation of new drug candidates with potential therapeutic benefits. 1-AMINO-PIPERIDINE-3-CARBOXYLIC ACID ETHYL ESTER's reactivity enables the formation of diverse molecular structures, contributing to the discovery of innovative medications.
Used in Alkaloid Synthesis:
1-Amino-piperidine-3-carboxylic acid ethyl ester is used as a starting material in the synthesis of alkaloids, which are naturally occurring organic compounds often found in plants. These alkaloids possess various biological activities and are used in the development of pharmaceuticals, agrochemicals, and other applications.
Check Digit Verification of cas no
The CAS Registry Mumber 938458-88-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,8,4,5 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 938458-88:
(8*9)+(7*3)+(6*8)+(5*4)+(4*5)+(3*8)+(2*8)+(1*8)=229
229 % 10 = 9
So 938458-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O2/c1-2-12-8(11)7-4-3-5-10(9)6-7/h7H,2-6,9H2,1H3
