93941-03-8 Usage
Uses
Used in Organic Synthesis:
Diethyl [(5-bromo-1H-indol-3-yl)methylene]malonate is used as a reagent for the preparation of various indole derivatives. Its unique structure allows for the formation of complex organic molecules, making it a valuable component in the synthesis of diverse chemical substances.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, diethyl [(5-bromo-1H-indol-3-yl)methylene]malonate is used as a building block for the development of potential pharmaceutical agents. Its indole scaffold, which is present in many bioactive natural products and drug molecules, makes it a promising candidate for creating new therapeutic compounds with potential applications in various medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 93941-03-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,4 and 1 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 93941-03:
(7*9)+(6*3)+(5*9)+(4*4)+(3*1)+(2*0)+(1*3)=148
148 % 10 = 8
So 93941-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H16BrNO4/c1-3-21-15(19)13(16(20)22-4-2)7-10-9-18-14-6-5-11(17)8-12(10)14/h5-9,18H,3-4H2,1-2H3
