93941-75-4 Usage
Molecular structure
2,9-bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-10,12,13-triene-4,7-dione has a complex and unique molecular structure, featuring two amino groups attached to a central cyclic molecule containing two oxygen atoms and multiple double bonds.
Amino groups
The compound contains two amino groups (-NH2) which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry.
Central cyclic molecule
The core of the compound is a cyclic molecule with a specific arrangement of atoms, which provides the basis for its structural properties and potential applications.
Multiple double bonds
The presence of multiple double bonds in the central cyclic molecule enhances the compound's reactivity and potential for use in organic synthesis.
Potential applications
Due to its structural features and reactivity, 2,9-bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-10,12,13-triene-4,7-dione has potential applications in the fields of organic synthesis and medicinal chemistry.
Novel drug development
The compound may be utilized in the development of new drugs, thanks to its unique molecular structure and reactivity.
Creation of new materials
The compound's specific properties make it a suitable candidate for the creation of new materials with potential applications in various scientific fields.
Research interest
The intricate molecular structure of 2,9-bis(aminomethyl)-3,8-dioxabicyclo[8.2.2]tetradeca-10,12,13-triene-4,7-dione makes it an interesting target for research and potential practical applications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 93941-75-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,4 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 93941-75:
(7*9)+(6*3)+(5*9)+(4*4)+(3*1)+(2*7)+(1*5)=164
164 % 10 = 4
So 93941-75-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2O4/c15-7-11-9-1-2-10(4-3-9)12(8-16)20-14(18)6-5-13(17)19-11/h1-4,11-12H,5-8,15-16H2
