939758-79-9 Usage
Uses
Used in Pharmaceutical Industry:
Methyl-1,2,3,4-tetrahydroisoquinoline-5-carboxylate is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. The presence of the carboxylate group and the tetrahydroisoquinoline moiety in its structure allows for potential use in the development of new drugs, particularly in the area of central nervous system medications.
Used in Chemical Research:
Methyl-1,2,3,4-tetrahydroisoquinoline-5-carboxylate is used as a research compound in academic and industrial laboratories. Its unique structure and potential for chemical reactions make it a valuable subject for studies aimed at understanding its reactivity, stability, and potential applications in various chemical processes.
Used in Material Science:
Methyl-1,2,3,4-tetrahydroisoquinoline-5-carboxylate is used as a building block in the development of new materials. Methyl-1,2,3,4-tetrahydroisoquinoline-5-carboxylate's structure may contribute to the creation of novel materials with unique properties, such as improved conductivity, enhanced stability, or specific interactions with other molecules, which could be beneficial in various applications, including electronics and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 939758-79-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,9,7,5 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 939758-79:
(8*9)+(7*3)+(6*9)+(5*7)+(4*5)+(3*8)+(2*7)+(1*9)=249
249 % 10 = 9
So 939758-79-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-14-11(13)10-4-2-3-8-7-12-6-5-9(8)10/h2-4,12H,5-7H2,1H3
