93980-65-5 Usage
Uses
Used in Dye and Pigment Production:
(4-aminophenyl)naphthylketone is used as a key intermediate in the production of dyes and pigments for various applications, such as textiles, plastics, and printing inks. Its unique chemical structure and properties contribute to the color intensity and stability of the resulting products.
Used in Organic Synthesis:
(4-aminophenyl)naphthylketone is used as a reagent in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its strong intermolecular interactions make it a valuable component in the synthesis of various compounds with potential therapeutic and agricultural applications.
Used in Advanced Materials and Coatings:
(4-aminophenyl)naphthylketone is used as a component in the development of advanced materials and coatings due to its strong intermolecular interactions. This property allows for the creation of materials with improved durability, stability, and performance in various applications, such as automotive, aerospace, and construction industries.
Used in Environmental Regulations:
(4-aminophenyl)naphthylketone is considered a potential environmental hazard, and its production and use are regulated in certain jurisdictions to minimize its potential toxicity and harmful effects on aquatic organisms. This regulation ensures that the compound is used responsibly and sustainably in industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 93980-65-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,8 and 0 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 93980-65:
(7*9)+(6*3)+(5*9)+(4*8)+(3*0)+(2*6)+(1*5)=175
175 % 10 = 5
So 93980-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H13NO/c18-14-10-8-13(9-11-14)17(19)16-7-3-5-12-4-1-2-6-15(12)16/h1-11H,18H2