94-21-3 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
4-[(2-Cyanoethyl)methylamino]benzaldehyde serves as an essential intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical structure allows it to be a key component in the development of new drugs and pesticides, contributing to advancements in healthcare and agriculture.
Used in Dye Industry:
As a dye intermediate, 4-[(2-Cyanoethyl)methylamino]benzaldehyde plays a crucial role in the production of various dyes. Its ability to form stable color compounds makes it valuable in the creation of dyes for textiles, plastics, and other materials, enhancing their colorfastness and performance.
Used in Rubber Chemical Industry:
In the rubber chemical industry, 4-[(2-Cyanoethyl)methylamino]benzaldehyde is utilized in the production of rubber chemicals. Its presence in these chemicals can improve the properties of rubber, such as its durability, flexibility, and resistance to environmental factors.
Used in Adhesive, Sealant, and Coating Industries:
4-[(2-Cyanoethyl)methylamino]benzaldehyde is also employed in the manufacturing of adhesives, sealants, and coatings. Its incorporation into these products can enhance their bonding strength, durability, and resistance to various conditions, making them more effective in their respective applications.
Check Digit Verification of cas no
The CAS Registry Mumber 94-21-3 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 9 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 94-21:
(4*9)+(3*4)+(2*2)+(1*1)=53
53 % 10 = 3
So 94-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O/c1-13(8-2-7-12)11-5-3-10(9-14)4-6-11/h3-6,9H,2,8H2,1H3
