94071-10-0 Usage
Description
(E)-[2-[3-[5-(acetylamino)-2-hydroxyphenyl]-3-oxo-1-propenyl]phenoxy]acetic acid is a complex organic compound with a phenoxyacetic acid backbone, featuring a phenyl group with 3-oxo-1-propenyl and acetylamino substituents. This molecule is a promising drug candidate with potential pharmaceutical properties, making it a subject of research for its unique structure and possible therapeutic effects.
Uses
Used in Pharmaceutical Industry:
(E)-[2-[3-[5-(acetylamino)-2-hydroxyphenyl]-3-oxo-1-propenyl]phenoxy]acetic acid is used as a potential drug candidate for its possible applications in medicine and biotechnology. Its unique structure and potential therapeutic effects make it a subject of interest for further research and development.
Used in Biotechnology Industry:
In the biotechnology sector, (E)-[2-[3-[5-(acetylamino)-2-hydroxyphenyl]-3-oxo-1-propenyl]phenoxy]acetic acid is utilized for its potential to contribute to the development of new therapeutic agents and treatments. Its specific functional groups and molecular configuration may offer novel approaches to addressing various health conditions and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 94071-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,7 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 94071-10:
(7*9)+(6*4)+(5*0)+(4*7)+(3*1)+(2*1)+(1*0)=120
120 % 10 = 0
So 94071-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H17NO6/c1-12(21)20-14-7-9-17(23)15(10-14)16(22)8-6-13-4-2-3-5-18(13)26-11-19(24)25/h2-10,23H,11H2,1H3,(H,20,21)(H,24,25)/b8-6+