94071-13-3 Usage
General Description
2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-butanol, also known as norharmane, is a naturally occurring indole alkaloid found in various food products and tobacco smoke. It is formed during the cooking or smoking of protein-containing foods, such as meat and fish, and has been shown to have potential mutagenic and neurotoxic effects. Norharmane has been associated with the formation of DNA adducts and is considered a possible contributor to the development of certain types of cancer. Additionally, it has been found to have a sedative effect and may be involved in the regulation of sleep and circadian rhythms. Studies have also suggested a potential link between norharmane exposure and neurodegenerative diseases such as Parkinson's and Alzheimer's.
Check Digit Verification of cas no
The CAS Registry Mumber 94071-13-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,7 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 94071-13:
(7*9)+(6*4)+(5*0)+(4*7)+(3*1)+(2*1)+(1*3)=123
123 % 10 = 3
So 94071-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O/c18-10-4-3-7-14-15-12(8-9-16-14)11-5-1-2-6-13(11)17-15/h1-2,5-6,14,16-18H,3-4,7-10H2
