941-87-7 Usage
Appearance
Yellow crystalline solid CDHQ has a yellow color and a crystalline structure, which is a common physical form for many chemical compounds.
Odor
Faint The compound has a very subtle and weak smell, making it less noticeable.
Usage as an intermediate
Synthesis of pharmaceuticals and agricultural chemicals CDHQ is commonly used as a starting material in the production of various drugs and chemicals for agriculture, helping to create the desired final products.
5. Antimicrobial properties CDHQ exhibits the ability to inhibit or kill microorganisms, such as bacteria and viruses, making it a potential candidate for treating infections.
6. Antifungal properties The compound also demonstrates the capability to counteract the growth and activity of fungi, which can be useful in treating fungal infections or controlling fungal growth in various settings.
7. Anticancer properties CDHQ has been found to possess properties that may help prevent or treat cancer, making it a focus of research for potential new cancer treatments.
Potential use in drug development
New drug development Due to its various beneficial properties, CDHQ is being studied for its possible application in creating novel pharmaceuticals.
Chelating agent
Laboratory research CDHQ can bind and complex with metal ions, making it useful as a chelating agent in laboratory research to study the effects of metal ions on various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 941-87-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,4 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 941-87:
(5*9)+(4*4)+(3*1)+(2*8)+(1*7)=87
87 % 10 = 7
So 941-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O/c11-7-12-9-4-2-1-3-8(9)5-6-10(12)13/h1-6,10,13H