94113-50-5 Usage
Uses
Used in Polymer Production:
3,3-Dimethyl-1,5-dioxacyclopentadecane-6,15-dione is utilized as a crosslinking agent, which is crucial for enhancing the strength and stability of polymers. Its ability to form crosslinks between polymer chains contributes to the improved mechanical properties and durability of the final product.
Used in Adhesive and Coating Manufacture:
As a solvent, 3,3-dimethyl-1,5-dioxacyclopentadecane-6,15-dione plays a significant role in the production of adhesives and coatings. Its solvent properties facilitate the even distribution of components and ensure a smooth application process, leading to high-quality and long-lasting adhesive and coating formulations.
Used in Plastics Production:
3,3-Dimethyl-1,5-dioxacyclopentadecane-6,15-dione also serves as a plasticizer, imparting flexibility and workability to certain types of plastics. By incorporating 3,3-dimethyl-1,5-dioxacyclopentadecane-6,15-dione into plastic materials, manufacturers can achieve desired levels of flexibility, elongation, and durability.
Used in Chemical Synthesis:
This versatile compound is employed in the chemical synthesis of other compounds, where its unique structure and reactivity contribute to the formation of new and useful products.
Used in Organic Chemistry Reactions:
3,3-Dimethyl-1,5-dioxacyclopentadecane-6,15-dione functions as a reagent in various organic chemistry reactions, enabling chemists to carry out specific transformations and syntheses that are essential for the development of new chemical entities and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 94113-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,1 and 3 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 94113-50:
(7*9)+(6*4)+(5*1)+(4*1)+(3*3)+(2*5)+(1*0)=115
115 % 10 = 5
So 94113-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H26O4/c1-15(2)11-18-13(16)9-7-5-3-4-6-8-10-14(17)19-12-15/h3-12H2,1-2H3
