94157-87-6 Usage
General Description
The chemical compound "(butyl)[2-(diethylammonio)ethyl](1-naphthoyl)ammonium hydrogen citrate" is a complex organic compound comprised of a butyl group, a diethylammonioethyl group, a 1-naphthoyl group, and a hydrogen citrate. It is likely a quaternary ammonium salt, which means it contains a positively charged ammonium ion attached to the citrate anion. The presence of the butyl, diethylammonioethyl, and 1-naphthoyl groups suggests that this compound may have potential use in organic synthesis, pharmaceuticals, or other chemical applications. The hydrogen citrate component indicates that it may have acidic properties and could potentially be used in pharmaceutical formulations or as a pH regulator. Further analysis and research would be necessary to fully understand the potential applications and properties of this complex chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 94157-87-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,1,5 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 94157-87:
(7*9)+(6*4)+(5*1)+(4*5)+(3*7)+(2*8)+(1*7)=156
156 % 10 = 6
So 94157-87-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H30N2O.C6H8O7/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20;7-3(8)1-6(13,5(11)12)2-4(9)10/h8-14H,4-7,15-17H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-1