942-56-3 Usage
Main properties of 5-HYDROXYCHROMAN
1. Naturally occurring chemical compound
2. Belongs to the class of chroman derivatives
3. Potent antioxidant
4. Found in various plant sources
5. Strong free radical scavenging activity
Specific content about 5-HYDROXYCHROMAN
1. Also known as 5-hydroxy-2,2,4-trimethyl-1,2-dihydrochromene
2. Important compound for the development of pharmaceuticals, nutraceuticals, and cosmetics
3. Linked to potential health benefits, such as protection against oxidative stress and inflammation
4. Significant interest from the scientific community for its potential therapeutic applications in various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 942-56-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,4 and 2 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 942-56:
(5*9)+(4*4)+(3*2)+(2*5)+(1*6)=83
83 % 10 = 3
So 942-56-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,4-5,10H,2-3,6H2
942-56-3Relevant academic research and scientific papers
Montmorillonite clays in organic synthesis: A one-pot conversion of phenols to 2,2-dimethylbenzopyrans
Dintzner, Matthew R.,McClelland, Kristen M.,Morse, Kara M.,Akroush, Michael H.
, p. 2028 - 2030 (2007/10/03)
2,2-Dimethylbenzopyran derivatives were generated through a one-pot Montmorillonite K10 clay-catalyzed condensation of substituted phenols with prenyl bromide.
