942206-33-9 Usage
Uses
Used in Organic Synthesis:
5-Iodo-3-methyl-2-methylaminopyridine is used as a building block in organic synthesis for the creation of various biologically active compounds. Its unique structure allows for a wide range of synthetic transformations, making it a versatile component in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-Iodo-3-methyl-2-methylaminopyridine is used as a key intermediate in the development of new drugs. Its iodine atom and methylamine group provide opportunities for further functionalization, which can lead to the discovery of novel therapeutic agents with improved pharmacological properties.
Used in Medicinal Chemistry:
5-Iodo-3-methyl-2-methylaminopyridine plays a significant role in medicinal chemistry, where it is utilized for the design and synthesis of potential drug candidates. Its unique structural features contribute to the development of compounds with specific biological activities, which can be optimized for therapeutic applications.
Overall, 5-Iodo-3-methyl-2-methylaminopyridine is a valuable compound in the fields of organic synthesis, pharmaceutical research, and medicinal chemistry due to its potential as a building block for the creation of biologically active molecules and its versatility in synthetic transformations.
Check Digit Verification of cas no
The CAS Registry Mumber 942206-33-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,2,2,0 and 6 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 942206-33:
(8*9)+(7*4)+(6*2)+(5*2)+(4*0)+(3*6)+(2*3)+(1*3)=149
149 % 10 = 9
So 942206-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9IN2/c1-5-3-6(8)4-10-7(5)9-2/h3-4H,1-2H3,(H,9,10)
