94232-35-6 Usage
Uses
Used in Pharmaceutical Synthesis:
[5-chloro-2-hydroxyphenyl]ammonium hydrogen sulphate is used as a reagent for the synthesis of pharmaceuticals, contributing to the development of new drugs and medications. Its unique chemical structure allows for specific reactions and transformations that are essential in the creation of various medicinal compounds.
Used in Agrochemical Production:
In the agrochemical industry, [5-chloro-2-hydroxyphenyl]ammonium hydrogen sulphate is used as a reagent for the synthesis of agrochemicals, such as pesticides and fertilizers. Its role in these processes helps to enhance crop protection and yield, ultimately contributing to global food security.
Used in Organic Compound Production:
[5-chloro-2-hydroxyphenyl]ammonium hydrogen sulphate serves as a building block for the production of various organic compounds, which can be used in a wide range of applications, from chemical manufacturing to the development of new materials with specific properties.
Safety and Environmental Considerations:
Given its potential irritant properties to the respiratory system and skin, [5-chloro-2-hydroxyphenyl]ammonium hydrogen sulphate requires careful handling and the implementation of proper safety measures. Additionally, due to the environmental risks it may pose in the event of spills or accidental releases, it is crucial to follow appropriate disposal and containment protocols to minimize any negative impact on the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 94232-35-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,2,3 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 94232-35:
(7*9)+(6*4)+(5*2)+(4*3)+(3*2)+(2*3)+(1*5)=126
126 % 10 = 6
So 94232-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClNO.H2O4S/c7-4-1-2-6(9)5(8)3-4;1-5(2,3)4/h1-3,9H,8H2;(H2,1,2,3,4)/p-1
