94276-13-8 Usage
Molecular structure
A complex structure consisting of a diazonium group attached to a benzene ring, with additional chlorine, nitro, methoxy, and methyl functional groups.
Diazonium group
A functional group with a positive charge (N2+) that is sensitive to light and can undergo various chemical reactions.
Benzene ring
Aromatic ring structure made up of six carbon atoms connected by alternating single and double bonds, contributing to the compound's stability and chemical properties.
Chlorine atom
A halogen element (Cl) attached to the benzene ring, which can increase the compound's reactivity and impart different properties.
Nitro group
A functional group (-NO2) attached to the benzene ring, which can enhance the compound's reactivity and contribute to its color.
Methoxy group
An electron-donating group (-OCH3) attached to the benzene ring, which can influence the compound's reactivity and stability.
Methyl group
A simple alkyl group (-CH3) attached to the benzene ring, which can affect the compound's reactivity and physical properties.
Hydrogen sulfate anion
A negatively charged ion (HSO4-) associated with the compound, which can participate in various chemical reactions and contribute to its solubility.
Use as a dye intermediate or dye
The azo group (N=N) in the compound imparts vibrant color to materials, making it suitable for use in the production of dyes and pigments.
Health hazards
The compound may pose health risks if mishandled or improperly used, so it is essential to handle it with care and follow appropriate safety precautions.
Check Digit Verification of cas no
The CAS Registry Mumber 94276-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,2,7 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 94276-13:
(7*9)+(6*4)+(5*2)+(4*7)+(3*6)+(2*1)+(1*3)=148
148 % 10 = 8
So 94276-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H11ClN5O3.H2O4S/c1-8-5-13(12(17-16)7-14(8)23-2)19-18-11-4-3-9(20(21)22)6-10(11)15;1-5(2,3)4/h3-7H,1-2H3;(H2,1,2,3,4)/q+1;/p-1