94291-57-3 Usage
Uses
Used in Flavor and Fragrance Industry:
Hepta-4,6-dien-2-one is utilized as a flavoring agent and fragrance due to its distinctive aromatic properties. Its ability to impart specific scents and tastes to products makes it valuable in the creation of perfumes, cosmetics, and food items.
Used in Organic Synthesis:
In the field of organic synthesis, hepta-4,6-dien-2-one serves as a building block for more complex molecules. Its reactive diene functional group allows for various chemical reactions, facilitating the synthesis of specialized compounds for specific purposes in research and industry.
Used in Research and Development:
hepta-4,6-dien-2-one's unique structure and reactivity make hepta-4,6-dien-2-one a valuable tool in research and development. It can be used to explore new chemical reactions, develop novel materials, and create innovative products across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 94291-57-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,2,9 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 94291-57:
(7*9)+(6*4)+(5*2)+(4*9)+(3*1)+(2*5)+(1*7)=153
153 % 10 = 3
So 94291-57-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O/c1-3-4-5-6-7(2)8/h3-5H,1,6H2,2H3/b5-4+
94291-57-3Relevant academic research and scientific papers
Br?nsted Base Catalyzed One-Pot Synthesis of Stereodefined Six-Member Carbocycles Featuring Transient Trienolates and a Key Intramolecular 1,6-Addition
Olaizola, Olatz,Iriarte, Igor,Zanella, Giovanna,Gómez-Bengoa, Enrique,Ganboa, I?aki,Oiarbide, Mikel,Palomo, Claudio
supporting information, p. 14250 - 14254 (2019/09/13)
A catalyst-driven one-pot reaction sequence is developed for the enantio- and diastereoselective synthesis of tetrasubstituted cyclohexenes from simple unsaturated ketones or thioesters. The method involves a tertiary amine/squaramide-catalyzed α-selective addition of transiently generated trienolates to nitroolefins, subsequent base-catalyzed double bond isomerization, and an intramolecular (vinylogous) 1,6-addition reaction, a rare key carbocyclization step that proceeded with essentially perfect stereocontrol.
