943736-58-1 Usage
Description
2-Amino-4-chloro-5H-pyrrolo[3,2-d]pyrimidine is a chlorinated pyrrolopyrimidine derivative with the molecular formula C5H4ClN5. It is characterized by the presence of an amino group at the 2nd position and a chlorine atom at the 4th position, which contribute to its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-Amino-4-chloro-5H-pyrrolo[3,2-d]pyrimidine is used as a key intermediate in the synthesis of compounds with antibacterial and antitumor activities. Its unique chemical structure allows for the development of new drugs that can target specific pathogens and cancer cells, offering potential therapeutic benefits in the treatment of various diseases.
Used in Chemical Research:
As a derivative of 4-Chloro-5H-pyrrolo[3,2-d]pyrimidine, 2-Amino-4-chloro-5H-pyrrolo[3,2-d]pyrimidine serves as a valuable compound for chemical research and development. It can be used to explore new chemical reactions, synthesis pathways, and potential applications in various fields, including materials science, agrochemicals, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 943736-58-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,3,7,3 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 943736-58:
(8*9)+(7*4)+(6*3)+(5*7)+(4*3)+(3*6)+(2*5)+(1*8)=201
201 % 10 = 1
So 943736-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN4/c7-5-4-3(1-2-9-4)10-6(8)11-5/h1-2,9H,(H2,8,10,11)
