94441-89-1 Usage
Description
BZ-LEU-BETANA, also known as N-(2-naphthyl)carboxamide, is a chemical compound obtained by the formal condensation of the carboxy group of N-benzoyl-L-leucine with the amino group of 2-naphthylamine. It is characterized by its unique structure and properties, making it a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
BZ-LEU-BETANA is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs and therapies.
Used in Chemical Research:
BZ-LEU-BETANA is used as a research compound in various chemical studies. Its unique properties and reactivity make it an interesting subject for researchers to explore and understand its potential applications and interactions with other compounds.
Used in Material Science:
BZ-LEU-BETANA can be used in material science for the development of new materials with specific properties. Its unique structure and chemical properties can be utilized to create materials with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 94441-89-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,4,4 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 94441-89:
(7*9)+(6*4)+(5*4)+(4*4)+(3*1)+(2*8)+(1*9)=151
151 % 10 = 1
So 94441-89-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H24N2O2/c1-16(2)14-21(25-22(26)18-9-4-3-5-10-18)23(27)24-20-13-12-17-8-6-7-11-19(17)15-20/h3-13,15-16,21H,14H2,1-2H3,(H,24,27)(H,25,26)