94442-10-1 Usage
Description
o-Cresolphthalein complexone disodium salt is a chemical compound that functions as an indicator in complexometric titrations, characterized by its ability to change color in response to the presence of metal ions, especially calcium and magnesium. In its deprotonated form, it forms a complex with these metal ions, leading to a color transition from violet to blue. This property makes it a valuable tool in analytical chemistry for determining the concentration of metal ions in a solution. Additionally, it finds applications in the pharmaceutical industry and as a pH indicator.
Uses
Used in Analytical Chemistry:
o-Cresolphthalein complexone disodium salt is used as an indicator in complexometric titrations for its ability to change color in the presence of metal ions, facilitating the determination of metal ion concentrations in a solution.
Used in Pharmaceutical Manufacturing:
o-Cresolphthalein complexone disodium salt is used as a component in the manufacturing of pharmaceuticals, likely due to its metal ion binding properties and its use as a pH indicator, which can be important for the stability and efficacy of certain medications.
Used as a pH Indicator:
o-Cresolphthalein complexone disodium salt is used as a pH indicator, capitalizing on its color change properties to signal variations in pH levels, which is crucial in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 94442-10-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,4,4 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 94442-10:
(7*9)+(6*4)+(5*4)+(4*4)+(3*2)+(2*1)+(1*0)=131
131 % 10 = 1
So 94442-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C32H32N2O12.Na/c1-17-7-19(9-21(30(17)43)11-33(13-25(35)36)14-26(37)38)29(23-5-3-4-6-24(23)32(45)46)20-8-18(2)31(44)22(10-20)12-34(15-27(39)40)16-28(41)42;/h3-10,43H,11-16H2,1-2H3,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,45,46);/q;+1/p-1/b29-20-;