944709-52-8 Usage
General Description
2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine is a chemical compound with the molecular formula C8H9BrN2. It is a heterocyclic compound that contains both nitrogen and bromine atoms. This chemical is used in the pharmaceutical industry as a building block for the synthesis of various biologically active compounds and pharmaceuticals. Its unique structure and properties make it a valuable intermediate for the development of new drugs and therapeutic agents. Additionally, it has potential applications in the field of organic synthesis and medicinal chemistry. However, due to its reactivity and potential hazards, proper handling and safety precautions should be followed when working with this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 944709-52-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,0 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 944709-52:
(8*9)+(7*4)+(6*4)+(5*7)+(4*0)+(3*9)+(2*5)+(1*2)=198
198 % 10 = 8
So 944709-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2/c9-8-2-1-6-5-10-4-3-7(6)11-8/h1-2,10H,3-5H2
