944709-52-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine is used as a key intermediate in the synthesis of various biologically active compounds and pharmaceuticals. Its distinctive structure and properties contribute to the development of new drugs and therapeutic agents, enhancing their efficacy and potential applications in treating various diseases and conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine serves as a valuable precursor for the creation of a wide range of organic compounds. Its reactivity and compatibility with various synthetic methods allow for the production of diverse chemical entities with potential applications in various industries.
Used in Medicinal Chemistry:
2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine is utilized in medicinal chemistry for the design and synthesis of novel drug candidates. Its unique structural features enable the development of compounds with improved pharmacological properties, such as enhanced potency, selectivity, and bioavailability.
Safety Precautions:
Due to the reactivity and potential hazards associated with 2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine, it is crucial to follow proper handling and safety precautions when working with 2-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine. This includes the use of appropriate personal protective equipment, working in well-ventilated areas, and adhering to established safety protocols to minimize risks and ensure a safe working environment.
Check Digit Verification of cas no
The CAS Registry Mumber 944709-52-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,0 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 944709-52:
(8*9)+(7*4)+(6*4)+(5*7)+(4*0)+(3*9)+(2*5)+(1*2)=198
198 % 10 = 8
So 944709-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2/c9-8-2-1-6-5-10-4-3-7(6)11-8/h1-2,10H,3-5H2
