944709-58-4 Usage
General Description
Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is a chemical compound with the molecular formula C11H8BrNO3. It is a derivative of furo[2,3-b]pyridine and is commonly used in the pharmaceutical industry for the synthesis of various biologically active compounds. This chemical is known for its versatile reactivity and has found application in the development of potential pharmaceuticals, particularly in the field of drug discovery and development.ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is of interest to researchers for its potential pharmacological properties and its ability to serve as a building block for the synthesis of various drugs and pharmaceutical compounds. Its unique structure and functional groups make it an important intermediate in the synthesis of bioactive molecules, thus making it a valuable chemical in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 944709-58-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,0 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 944709-58:
(8*9)+(7*4)+(6*4)+(5*7)+(4*0)+(3*9)+(2*5)+(1*8)=204
204 % 10 = 4
So 944709-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrNO3/c1-2-14-10(13)7-3-6-4-8(11)15-9(6)12-5-7/h3-5H,2H2,1H3
