944709-63-1 Usage
General Description
6-Bromo-2,3-Dihydrobenzofuran-3-amine Hydrochloride is a specialized chemical compound. As its name indicates, it's a benzofuran derivative that carries additional functional groups, such as an amine and a bromine atom. The molecule also contains an additional hydrogen chloride component, which allows it to exist in form of a hydrochloride salt, possibly enhancing its water solubility. Despite its complex structure, the potential applications of this compound are not explicitly established. However, benzofuran derivatives are generally recognized for their uses in pharmaceuticals and have been studied for the potential biological activities such as anti-inflammatory, anti-microbial, and anti-cancer properties. But, specific use and potential of 6-Bromo-2,3-Dihydrobenzofuran-3-amine Hydrochloride would need to be assessed through further investigation and studies.
Check Digit Verification of cas no
The CAS Registry Mumber 944709-63-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,0 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 944709-63:
(8*9)+(7*4)+(6*4)+(5*7)+(4*0)+(3*9)+(2*6)+(1*3)=201
201 % 10 = 1
So 944709-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrNO.ClH/c9-5-1-2-6-7(10)4-11-8(6)3-5;/h1-3,7H,4,10H2;1H
944709-63-1Relevant articles and documents
ALPHA, BETA-UNSATURATED AMIDE COMPOUND
-
Paragraph 1246; 1284, (2020/12/10)
An object of the present invention is to provide an α,β-unsaturated amide compound or a pharmaceutically acceptable salt or the like thereof having anticancer activity and the like. The α,β-unsaturated amide compound represented by the following formula (I) or a pharmaceutically acceptable salt or the like thereof has anticancer activity and the like: [wherein, "A" represents optionally substituted heterocyclic diyl, R1 represents hydrogen atom or optionally substituted lower alkyl, R2 represents optionally substituted aryl, optionally substituted cycloalkyl, optionally substituted aliphatic heterocyclic group or optionally substituted aromatic heterocyclic group, X represents -O-, -S-, -SO2-, -NRX1- (wherein, RX1 represents hydrogen atom or lower alkyl), -CHRX2- (wherein, RX2 represents hydrogen atom or hydroxy), -CH=CH-, -CO- or -NH-CO-, and n1 and n2 are the same or different, and each represents 0 or 1].
NEW ARYL-BENZOCYCLOALKYL AMIDE DERIVATIVES
-
Paragraph 0333-0334, (2013/03/26)
The invention provides novel compounds having the general formula (I) wherein R1, R2, R3, R4, R5, R6, R7, R8, R9, R10, R11, R12, A1, A2 and n are as described herein, compositions including the compounds and methods of using the compounds.
