944718-32-5 Usage
Uses
Used in Pharmaceutical Synthesis:
6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole is utilized as a key building block in the creation of biologically active compounds and pharmaceutical drugs. Its unique structure and reactivity contribute to the development of new therapeutic agents with potential applications in medicine.
Used in Organic Synthesis:
In the realm of organic synthesis, 6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole serves as an intermediate for the synthesis of various organic compounds. Its chemical properties allow for the formation of new molecules with specific functionalities, broadening the scope of organic chemistry.
Used in Material Science Research:
6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole is employed in the development and research of new materials and chemical compounds. Its versatility and stability make it an attractive candidate for exploring novel materials with unique properties and potential applications in various industries.
Used in Chemical Compound Development:
6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole is also used in the development of new chemical entities, where its reactivity and stability are leveraged to create innovative molecules with specific characteristics. This contributes to the advancement of chemistry and the discovery of new compounds with potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 944718-32-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,1 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 944718-32:
(8*9)+(7*4)+(6*4)+(5*7)+(4*1)+(3*8)+(2*3)+(1*2)=195
195 % 10 = 5
So 944718-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrN3/c1-11-7-4-5(8)2-3-6(7)9-10-11/h2-4H,1H3
