944900-87-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, including antiviral and antibacterial agents. 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine's ability to be modified and incorporated into larger molecular frameworks makes it a versatile component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine serves as a crucial building block for the creation of novel agrochemicals. Its potential as an antiviral and antibacterial agent can be harnessed to develop pesticides and other protective agents for crops, contributing to enhanced agricultural productivity and crop protection strategies.
Used in Medicinal Chemistry Research:
3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine is employed as a subject of study in medicinal chemistry research. Its unique structural features and potential biological activities make it an attractive compound for exploring new drug discovery avenues. Researchers can investigate its interactions with biological targets and evaluate its efficacy in treating various diseases, thereby contributing to the advancement of pharmaceutical science.
Used in Drug Discovery:
As a compound with demonstrated potential in biological activities, 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine is used in drug discovery processes. Its unique structure provides a foundation for the design and development of new therapeutic agents, with applications in various medical fields. 3-Bromo-5,6,7,8-tetrahydro-imidazo[1,5-a]pyrazine's adaptability in chemical modifications makes it a valuable asset in the search for innovative and effective treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 944900-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 944900-87:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*0)+(2*8)+(1*7)=192
192 % 10 = 2
So 944900-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrN3/c7-6-9-4-5-3-8-1-2-10(5)6/h4,8H,1-3H2
