944901-59-1 Usage
Uses
Used in Medicinal Chemistry:
2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is used as a building block for the synthesis of various pharmaceutical compounds. Its heterocyclic structure allows for the development of new drugs with potential therapeutic applications.
Used in Drug Development:
In the pharmaceutical industry, 2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is utilized as a key intermediate in the design and synthesis of novel drug candidates. Its unique chemical properties and potential biological activity make it a valuable component in the creation of new medications.
Used in Organic Chemistry Research:
2-chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine serves as a subject of study in organic chemistry, where its properties, reactivity, and potential applications are explored. This research contributes to the understanding of heterocyclic compounds and their role in various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 944901-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 944901-59:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*1)+(2*5)+(1*9)=191
191 % 10 = 1
So 944901-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClN3/c8-7-10-4-5-3-9-2-1-6(5)11-7/h4,9H,1-3H2
944901-59-1Relevant articles and documents
FUSED HETEROCYCLIC COMPOUNDS AS S1P MODULATORS
-
Page/Page column 75, (2017/03/28)
The invention relates to heterocyclic compounds as S1P modulators, pharmaceutical compositions comprising such compounds, and uses thereof in the treatment, alleviation or prevention of diseases or disorders mediated by an S1P receptor.
