944904-66-9 Usage
Uses
Used in Pharmaceutical Industry:
(6-Bromo-1h-indazol-3-yl)-acetic acid is used as a building block for the synthesis of biologically active compounds due to its specific chemical structure and properties. It contributes to the development of novel drugs, enhancing the therapeutic potential of various medications.
Used in Organic Synthesis:
In the field of organic synthesis, (6-Bromo-1h-indazol-3-yl)-acetic acid is utilized as a key intermediate, facilitating the creation of complex organic molecules. Its reactivity and functional groups make it a versatile component in the synthesis of a wide range of chemical products.
Used in Medicinal Chemistry:
(6-Bromo-1h-indazol-3-yl)-acetic acid is employed as a valuable compound in medicinal chemistry for its potential to be incorporated into new drug candidates. Its distinct chemical properties allow for targeted modifications, potentially leading to improved pharmacological profiles and therapeutic effects.
Overall, (6-Bromo-1h-indazol-3-yl)-acetic acid is a multifaceted chemical compound with broad applications across various industries, particularly in the development of innovative pharmaceuticals and organic synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 944904-66-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,9,0 and 4 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 944904-66:
(8*9)+(7*4)+(6*4)+(5*9)+(4*0)+(3*4)+(2*6)+(1*6)=199
199 % 10 = 9
So 944904-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c10-5-1-2-6-7(3-5)11-12-8(6)4-9(13)14/h1-3H,4H2,(H,11,12)(H,13,14)
