945265-09-8 Usage
General Description
5-CHLORO-3-METHYL-1H-INDAZOLE is a chemical compound with the molecular formula C9H7ClN2. It is a chlorinated derivative of 3-methylindazole, which is a heterocyclic compound commonly used in organic synthesis and pharmaceutical development. 5-CHLORO-3-METHYL-1H-INDAZOLE has potential applications in the synthesis of various pharmaceuticals and agrochemicals due to its unique structure and reactivity. It is also used as a building block in the production of dyes, pigments, and other fine chemicals. Additionally, it may have biological activity and could potentially be used as a starting material for the development of novel drugs and biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 945265-09-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,5,2,6 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 945265-09:
(8*9)+(7*4)+(6*5)+(5*2)+(4*6)+(3*5)+(2*0)+(1*9)=188
188 % 10 = 8
So 945265-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN2/c1-5-7-4-6(9)2-3-8(7)11-10-5/h2-4H,1H3,(H,10,11)
