94630-53-2 Usage
Description
1,1'-(Decane-1,10-diyl)bis[4-aza-1-azoniabicyclo[2.2.2]octane] Dibromide, with the chemical formula C24H50Br2N4, is a complex organic compound characterized by its unique structure that includes a decane-1,10-diyl bridge connecting two 4-aza-1-azoniabicyclo[2.2.2]octane units. This structure endows it with specific properties that make it suitable for various applications, particularly in the field of ion channel modulation.
Uses
Used in Pharmaceutical Industry:
1,1'-(Decane-1,10-diyl)bis[4-aza-1-azoniabicyclo[2.2.2]octane] Dibromide is used as a modulating agent for ion channels, playing a crucial role in the development of drugs targeting specific ion channels. This application is vital for treating a range of conditions, including neurological disorders, cardiovascular diseases, and other ion channelopathies.
Used in Research and Development:
In the field of scientific research, 1,1'-(Decane-1,10-diyl)bis[4-aza-1-azoniabicyclo[2.2.2]octane] Dibromide serves as a valuable tool for studying the function and behavior of ion channels. It aids researchers in understanding the mechanisms of action and potential therapeutic effects of various compounds on ion channels, thereby contributing to the advancement of medical knowledge and drug discovery.
Used in Diagnostic Applications:
1,1'-(Decane-1,10-diyl)bis[4-aza-1-azoniabicyclo[2.2.2]octane] Dibromide can also be employed in diagnostic applications, where it may be utilized to assess the activity and function of ion channels in various biological samples. This can help in the identification and monitoring of diseases associated with ion channel dysfunction, providing valuable insights for clinicians and researchers alike.
Overall, 1,1'-(Decane-1,10-diyl)bis[4-aza-1-azoniabicyclo[2.2.2]octane] Dibromide is a versatile compound with significant potential in various applications, particularly in the pharmaceutical, research, and diagnostic industries, due to its ability to modulate ion channels effectively.
Check Digit Verification of cas no
The CAS Registry Mumber 94630-53-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,6,3 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 94630-53:
(7*9)+(6*4)+(5*6)+(4*3)+(3*0)+(2*5)+(1*3)=142
142 % 10 = 2
So 94630-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H44N4.2BrH/c1(3-5-7-15-25-17-9-23(10-18-25)11-19-25)2-4-6-8-16-26-20-12-24(13-21-26)14-22-26;;/h1-22H2;2*1H/q+2;;/p-2
94630-53-2Relevant articles and documents
METHODS FOR MODULATING ION CHANNELS
-
Page/Page column 30-31, (2008/06/13)
In one embodiment, the invention provides an ion having the formula : (I) In another embodiment, the invention provides a method for modulating potassium, sodium, and cyclic nucleotide-modulated ion channels in a mammal in need thereof. In a further embodiment, the invention provides a method for modulating ligand-gated ion channels or transient receptor potential channels in a mammal in need thereof. The methods comprise administering an ion having the formula described above.