946670-72-0 Usage
Uses
Used in Organic Compounds Production:
3-methoxy-4-(3-methoxypropoxy)benzaldehyde is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of a wide range of chemical products, contributing to the advancement of the chemical industry.
Used in Flavoring Agent for Food Industry:
3-methoxy-4-(3-methoxypropoxy)benzaldehyde is utilized as a flavoring agent in the food industry. Its aromatic properties provide a distinct flavor profile, enhancing the taste and aroma of various food products.
Used in Pharmaceutical Industry:
3-methoxy-4-(3-methoxypropoxy)benzaldehyde is employed in the pharmaceutical industry for the synthesis of drugs and other bioactive compounds. Its chemical structure offers potential for the development of new therapeutic agents, contributing to the discovery of novel treatments and medications.
Check Digit Verification of cas no
The CAS Registry Mumber 946670-72-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,6,6,7 and 0 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 946670-72:
(8*9)+(7*4)+(6*6)+(5*6)+(4*7)+(3*0)+(2*7)+(1*2)=210
210 % 10 = 0
So 946670-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O4/c1-14-6-3-7-16-11-5-4-10(9-13)8-12(11)15-2/h4-5,8-9H,3,6-7H2,1-2H3
