947533-25-7 Usage
Uses
Used in Organic Synthesis:
3-Cyanomethoxyphenylboronic acid is utilized as a reagent for facilitating key bond-forming reactions in the construction of complex organic molecules. Its ability to selectively bond with diols and Lewis basic functional groups makes it a valuable component in the synthesis process.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Cyanomethoxyphenylboronic acid is employed as a precursor in the development of new drugs and bioactive compounds. Its unique bonding capabilities contribute to the creation of innovative pharmaceutical agents with potential therapeutic applications.
Used in Advanced Materials Production:
3-Cyanomethoxyphenylboronic acid is used as a building block in the production of advanced materials. Its versatile reactivity allows for the creation of materials with specialized properties, suitable for various high-performance applications.
Used in Fine Chemicals Industry:
Within the fine chemicals sector, 3-Cyanomethoxyphenylboronic acid is leveraged for its potential in the synthesis of high-purity specialty chemicals. Its selective bonding properties are harnessed to produce compounds with specific functionalities required in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 947533-25-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,7,5,3 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 947533-25:
(8*9)+(7*4)+(6*7)+(5*5)+(4*3)+(3*3)+(2*2)+(1*5)=197
197 % 10 = 7
So 947533-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BNO3/c10-4-5-13-8-3-1-2-7(6-8)9(11)12/h1-3,6,11-12H,5H2
