947534-69-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2,5-Dibromo-4-methyl-3-nitropyridine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be readily modified and incorporated into complex molecular structures. Its strong electron-withdrawing properties facilitate the formation of new chemical bonds, making it a versatile component in the development of novel drug candidates.
Used in Organic Chemistry Research:
In the field of organic chemistry, 2,5-Dibromo-4-methyl-3-nitropyridine is utilized as a reagent and building block for the preparation of various organic compounds. Its unique structural features and reactivity make it a valuable tool for exploring new synthetic pathways and developing innovative chemical reactions.
Used in Chemical Intermediate Production:
2,5-Dibromo-4-methyl-3-nitropyridine is employed as a starting material in the production of a wide range of chemical intermediates. Its ability to undergo various chemical transformations allows for the creation of diverse compounds with potential applications in different industries, such as agrochemicals, dyes, and polymers.
Used in Environmental and Health Risk Assessment:
Due to its potential health and environmental risks, 2,5-Dibromo-4-methyl-3-nitropyridine is also used in studies and assessments aimed at understanding and mitigating its impact. This includes research on safe handling, storage, and disposal methods, as well as investigations into its toxicological profile and potential effects on ecosystems.
It is crucial to handle and store 2,5-Dibromo-4-methyl-3-nitropyridine with caution, adhering to strict safety protocols to minimize its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 947534-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,7,5,3 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 947534-69:
(8*9)+(7*4)+(6*7)+(5*5)+(4*3)+(3*4)+(2*6)+(1*9)=212
212 % 10 = 2
So 947534-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4Br2N2O2/c1-3-4(7)2-9-6(8)5(3)10(11)12/h2H,1H3
