948014-34-4 Usage
Uses
Used in Organic Synthesis:
2-Amino-3-chloro-4-fluoronitrobenzene is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows for a range of reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 2-Amino-3-chloro-4-fluoronitrobenzene is used as a building block for the development of new drugs. Its presence in the molecular structure can impart specific properties to the final product, such as increased potency or selectivity towards target receptors.
Used in Agrochemical Production:
Similarly, in the agrochemical sector, 2-AMINO-3-CHLORO-4-FLUORONITROBENZENE is utilized as a precursor for the synthesis of various agrochemicals, including pesticides and herbicides. Its unique functional groups enable the creation of molecules with targeted effects on pests or weeds.
Used in Material Development:
2-Amino-3-chloro-4-fluoronitrobenzene also has potential applications in the development of new materials, such as polymers and coatings, due to its chemical reactivity and the ability to form stable bonds with other molecules.
Used in Dye and Pigment Production:
Furthermore, 2-AMINO-3-CHLORO-4-FLUORONITROBENZENE is used as an intermediate in the production of dyes and pigments, where its chemical properties contribute to the color and stability of the final products.
It is crucial to handle 2-Amino-3-chloro-4-fluoronitrobenzene with care and adhere to proper safety protocols due to its potential hazards, ensuring the safety of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 948014-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,8,0,1 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 948014-34:
(8*9)+(7*4)+(6*8)+(5*0)+(4*1)+(3*4)+(2*3)+(1*4)=174
174 % 10 = 4
So 948014-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClFN2O2/c7-5-3(8)1-2-4(6(5)9)10(11)12/h1-2H,9H2