949100-11-2 Usage
Uses
(4-Fluoropiperidin-4-yl)methanol is used as a chemical intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure, including the fluorine atom and methanol group, provides it with specific reactivity and properties that make it valuable in the development of new compounds with potential therapeutic or pesticidal applications.
Used in Pharmaceutical Industry:
(4-Fluoropiperidin-4-yl)methanol is used as a building block for the synthesis of new drug candidates, particularly in the area of central nervous system (CNS) active compounds. Its presence in the molecular structure can influence the pharmacokinetic and pharmacodynamic properties of the final drug, potentially leading to improved efficacy or reduced side effects.
Used in Agrochemical Industry:
(4-Fluoropiperidin-4-yl)methanol is used as a precursor in the development of new agrochemicals, such as insecticides or herbicides. The incorporation of (4-fluoropiperidin-4-yl)methanol into the molecular structure of these products can enhance their effectiveness in controlling pests or weeds, while also potentially reducing the environmental impact of their use.
Check Digit Verification of cas no
The CAS Registry Mumber 949100-11-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,9,1,0 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 949100-11:
(8*9)+(7*4)+(6*9)+(5*1)+(4*0)+(3*0)+(2*1)+(1*1)=162
162 % 10 = 2
So 949100-11-2 is a valid CAS Registry Number.
InChI:InChI=1S/C6H12FNO/c7-6(5-9)1-3-8-4-2-6/h8-9H,1-5H2
