94944-77-1 Usage
General Description
(Z,Z)-2-(8-heptadecenyl)-4,5-dihydro-1-methyl-3-[2-[(1-oxo-9-octadecenyl)amino]ethyl]-1H-imidazolium methyl sulphate is a complex compound with a long chemical name. It is a type of imidazolium salt that contains a long hydrocarbon chain. (Z,Z)-2-(8-heptadecenyl)-4,5-dihydro-1-methyl-3-[2-[(1-oxo-9-octadecenyl)amino]ethyl]-1H-imidazolium methyl sulphate is often used in the synthesis of ionic liquids, which are versatile solvents with applications in various fields such as organic synthesis, catalysis, and electrochemistry. The specific structure and properties of this chemical make it useful in the development of new materials and processes. Additionally, its long hydrocarbon chain makes it a potential candidate for use as a surfactant or in the development of new pharmaceutical compounds. Overall, (Z,Z)-2-(8-heptadecenyl)-4,5-dihydro-1-methyl-3-[2-[(1-oxo-9-octadecenyl)amino]ethyl]-1H-imidazolium methyl sulphate has significant potential for various applications in the chemical and pharmaceutical industries due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 94944-77-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,9,4 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 94944-77:
(7*9)+(6*4)+(5*9)+(4*4)+(3*4)+(2*7)+(1*7)=181
181 % 10 = 1
So 94944-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C41H79N3O.CH4O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40(45)42-36-37-44-39-38-43(3)41(44)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5-6(2,3)4/h18-21,41H,4-17,22-39H2,1-3H3,(H,42,45);1H3,(H,2,3,4)/b20-18-,21-19-;