95104-21-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-cyanoquinoline is used as a key building block for the synthesis of various pharmaceuticals due to its potential biological activity. It contributes to the development of new drugs for a range of therapeutic applications, including antimalarial and anti-inflammatory properties, enhancing treatment options for various health conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-3-cyanoquinoline serves as a vital component in the creation of agrochemicals, playing a significant role in pest control and crop protection, thereby ensuring agricultural productivity and food security.
Used in Fine Chemicals Production:
2-Chloro-3-cyanoquinoline is utilized as an intermediate in the production of fine chemicals, which are essential in various industries such as cosmetics, fragrances, and specialty chemicals. Its presence in these compounds allows for the development of high-quality products with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 95104-21-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,1,0 and 4 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 95104-21:
(7*9)+(6*5)+(5*1)+(4*0)+(3*4)+(2*2)+(1*1)=115
115 % 10 = 5
So 95104-21-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H5ClN2/c11-10-8(6-12)5-7-3-1-2-4-9(7)13-10/h1-5H
