951625-85-7 Usage
Uses
Used in Pharmaceutical Industry:
3-methyl-2-(1H-tetrazol-5yl) benzothiophene is used as a pharmaceutical compound for its diverse biological activities, which can be harnessed for the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
3-methyl-2-(1H-tetrazol-5yl) benzothiophene is used as an agrochemical compound, potentially for the development of new pesticides or other agricultural chemicals, due to its interesting properties and potential biological activities.
Used in Dye Industry:
3-methyl-2-(1H-tetrazol-5yl) benzothiophene is used as a dye compound, where its unique chemical structure may contribute to the creation of new dyes with specific color properties or other characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 951625-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,1,6,2 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 951625-85:
(8*9)+(7*5)+(6*1)+(5*6)+(4*2)+(3*5)+(2*8)+(1*5)=187
187 % 10 = 7
So 951625-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N4S/c1-6-7-4-2-3-5-8(7)15-9(6)10-11-13-14-12-10/h2-5H,1H3,(H,11,12,13,14)
