952182-19-3 Usage
Uses
Used in Chemical Synthesis:
Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is used as a reagent in chemical synthesis for its reactivity and ability to participate in various chemical reactions. Its unique structure allows it to be a valuable component in the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is used as a building block for the development of new pharmaceutical compounds. Its reactivity and structural features make it a promising candidate for the synthesis of potential drug molecules.
Used in Chemical Research:
Methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is also used in chemical research to explore its properties and potential applications. Its specialized or emerging applications in precise chemical synthesis and research fields contribute to the advancement of scientific knowledge and the development of new technologies.
Note: Due to the limited information on the specific uses and properties of methyl 5-chloro-1H-pyridine-2-carboxylate, the above uses are based on its general role in chemical synthesis, medicinal chemistry, and research. Further investigation and research may reveal more specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 952182-19-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,2,1,8 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 952182-19:
(8*9)+(7*5)+(6*2)+(5*1)+(4*8)+(3*2)+(2*1)+(1*9)=173
173 % 10 = 3
So 952182-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c1-14-9(13)7-3-5-2-6(10)4-11-8(5)12-7/h2-4H,1H3,(H,11,12)
