952319-71-0 Usage
Uses
Used in Organic Synthesis:
2-Methylindazole-5-boronic acid is used as a versatile building block in organic synthesis for the preparation of various functionalized indazole derivatives. Its unique structural properties and functional groups make it a valuable component in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Methylindazole-5-boronic acid is used as a potential intermediate in the synthesis of drug molecules. Its ability to form stable complexes with other compounds and its reactivity in various chemical reactions make it a promising candidate for the development of new pharmaceuticals.
Used in Chemical Research:
2-Methylindazole-5-boronic acid is utilized in chemical research to explore its properties and potential applications. Its unique structure and functional groups provide opportunities for studying its reactivity, stability, and interactions with other compounds, contributing to the advancement of chemical knowledge.
Used in Medicine:
2-Methylindazole-5-boronic acid has potential applications in the field of medicine due to its unique structural properties and functional groups. It may be used in the development of new drugs or as a component in drug delivery systems, offering potential therapeutic benefits.
Used in Agriculture:
In agriculture, 2-Methylindazole-5-boronic acid may find use in the development of new agrochemicals or as a component in existing formulations. Its unique properties could contribute to the creation of more effective and targeted agricultural products.
Used in Materials Science:
2-Methylindazole-5-boronic acid's potential applications in materials science stem from its unique structural properties and functional groups. It may be used in the development of new materials with specific properties, such as improved stability, reactivity, or other desirable characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 952319-71-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,5,2,3,1 and 9 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 952319-71:
(8*9)+(7*5)+(6*2)+(5*3)+(4*1)+(3*9)+(2*7)+(1*1)=180
180 % 10 = 0
So 952319-71-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BN2O2/c1-11-5-6-4-7(9(12)13)2-3-8(6)10-11/h2-5,12-13H,1H3
952319-71-0Relevant academic research and scientific papers
THYROID HORMONE RECEPTOR BETA AGONIST COMPOUNDS
-
Paragraph 0195, (2021/03/05)
Provided herein are compounds, preferably thyroid hormone receptor beta (THR beta) agonist compounds, compositions thereof, and methods of their preparation, and methods of agonizing THR beta and methods for treating disorders mediated by THR beta.
