95233-36-6 Usage
Uses
Used in Chemical Synthesis:
4'-Acetylcyclohexyl chlorobenzene is used as a reagent in various chemical reactions for the synthesis of organic materials and pharmaceuticals. Its unique structure allows it to participate in a wide range of reactions, making it a versatile compound in the field of organic chemistry.
Used in Perfume and Fragrance Industry:
4'-Acetylcyclohexyl chlorobenzene is used as a fragrance compound in the perfume industry. Its aromatic properties contribute to the creation of various scents and fragrances, enhancing the sensory experience of consumers.
Used in Dye Manufacturing:
In the dye manufacturing industry, 4'-Acetylcyclohexyl chlorobenzene is used as a component in the production of various dyes. Its chemical properties allow it to be incorporated into dyes that can be used in textiles, paints, and other applications.
Used in Pharmaceutical Drug Synthesis:
4'-Acetylcyclohexyl chlorobenzene is used in the synthesis of various pharmaceutical drugs. Its high purity and stability make it an ideal compound for use in the development of new medications and therapies.
Overall, 4'-Acetylcyclohexyl chlorobenzene is a versatile chemical compound with a wide range of applications in various industries, including chemical synthesis, perfume and fragrance, dye manufacturing, and pharmaceutical drug synthesis. Its unique properties and high purity make it a valuable asset in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 95233-36-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,2,3 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 95233-36:
(7*9)+(6*5)+(5*2)+(4*3)+(3*3)+(2*3)+(1*6)=136
136 % 10 = 6
So 95233-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H17ClO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h6-9,11-12H,2-5H2,1H3
