95233-36-6 Usage
General Description
4'-Acetylcyclohexyl chlorobenzene is a chemical compound that is commonly used in the production of organic materials and pharmaceuticals. It is a derivative of chlorobenzene, with a cyclohexyl and acetyl group attached to the 4' position. 4'-ACETYLCYCLOHEXYL CHLOROBENZENE is known for its ability to act as a solvent and a reagent in various chemical reactions. It is also utilized in the manufacturing of perfumes, dyes, and fragrance compounds. Additionally, it is used in the synthesis of various pharmaceutical drugs and is known for its high purity and stability.
Check Digit Verification of cas no
The CAS Registry Mumber 95233-36-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,5,2,3 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 95233-36:
(7*9)+(6*5)+(5*2)+(4*3)+(3*3)+(2*3)+(1*6)=136
136 % 10 = 6
So 95233-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H17ClO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h6-9,11-12H,2-5H2,1H3
